C17H14O4S — CID 14176858
ethyl 1,3-dioxo-1-phenyl-1-benzothiophene-2-carboxylate (PubChem CID 14176858) has the molecular formula C17H14O4S and a molecular weight of 314.36 g/mol. Its IUPAC name is ethyl 1,3-dioxo-1-phenyl-1-benzothiophene-2-carboxylate.
| Compound Name | ethyl 1,3-dioxo-1-phenyl-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 14176858 |
| Molecular Formula | C17H14O4S |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | ethyl 1,3-dioxo-1-phenyl-1-benzothiophene-2-carboxylate |
| SMILES | CCOC(=O)C1=S(=O)(c2ccccc2)c2ccccc2C1=O |
| InChI | InChI=1S/C17H14O4S/c1-2-21-17(19)16-15(18)13-10-6-7-11-14(13)22(16,20)12-8-4-3-5-9-12/h3-11H,2H2,1H3 |
| InChIKey | OLNMVOJXFWFKRO-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|