C13H14O4S — CID 12741891
1,1-dioxo-3-(propoxymethyl)thiochromen-4-one (PubChem CID 12741891) has the molecular formula C13H14O4S and a molecular weight of 266.32 g/mol. Its IUPAC name is 1,1-dioxo-3-(propoxymethyl)thiochromen-4-one.
| Compound Name | 1,1-dioxo-3-(propoxymethyl)thiochromen-4-one |
|---|---|
| PubChem CID | 12741891 |
| Molecular Formula | C13H14O4S |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | 1,1-dioxo-3-(propoxymethyl)thiochromen-4-one |
| SMILES | CCCOCC1=CS(=O)(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C13H14O4S/c1-2-7-17-8-10-9-18(15,16)12-6-4-3-5-11(12)13(10)14/h3-6,9H,2,7-8H2,1H3 |
| InChIKey | CXUHYSPTACLCKW-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|