C26H24O7S — CID 11190815
dimethyl 8-(benzenesulfonyl)-2-oxo-3-phenyl-1,4,5,7-tetrahydroazulene-6,6-dicarboxylate (PubChem CID 11190815) has the molecular formula C26H24O7S and a molecular weight of 480.54 g/mol. Its IUPAC name is dimethyl 8-(benzenesulfonyl)-2-oxo-3-phenyl-1,4,5,7-tetrahydroazulene-6,6-dicarboxylate.
| Compound Name | dimethyl 8-(benzenesulfonyl)-2-oxo-3-phenyl-1,4,5,7-tetrahydroazulene-6,6-dicarboxylate |
|---|---|
| PubChem CID | 11190815 |
| Molecular Formula | C26H24O7S |
| Molecular Weight | 480.54 g/mol |
| Exact Mass | 480.12 |
| IUPAC Name | dimethyl 8-(benzenesulfonyl)-2-oxo-3-phenyl-1,4,5,7-tetrahydroazulene-6,6-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CCC2=C(c3ccccc3)C(=O)CC2=C(S(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C26H24O7S/c1-32-24(28)26(25(29)33-2)14-13-19-20(15-21(27)23(19)17-9-5-3-6-10-17)22(16-26)34(30,31)18-11-7-4-8-12-18/h3-12H,13-16H2,1-2H3 |
| InChIKey | JJHVBDAJPWAJRD-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.54 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|