C21H24O5S — CID 10620316
tert-butyl (2S,3R)-3-(benzenesulfonyl)-2-benzoylbutanoate (PubChem CID 10620316) has the molecular formula C21H24O5S and a molecular weight of 388.49 g/mol. Its IUPAC name is tert-butyl (2S,3R)-3-(benzenesulfonyl)-2-benzoylbutanoate.
| Compound Name | tert-butyl (2S,3R)-3-(benzenesulfonyl)-2-benzoylbutanoate |
|---|---|
| PubChem CID | 10620316 |
| Molecular Formula | C21H24O5S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | tert-butyl (2S,3R)-3-(benzenesulfonyl)-2-benzoylbutanoate |
| SMILES | C[C@H]([C@H](C(=O)OC(C)(C)C)C(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C21H24O5S/c1-15(27(24,25)17-13-9-6-10-14-17)18(20(23)26-21(2,3)4)19(22)16-11-7-5-8-12-16/h5-15,18H,1-4H3/t15-,18+/m1/s1 |
| InChIKey | AWTWGBWCSYICGL-QAPCUYQASA-N |
| XLogP | 3.69 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|