C25H24O6S — CID 11419606
dimethyl 2-[2-(benzenesulfonyl)buta-2,3-dienyl]-2-(4-phenylbut-3-ynyl)propanedioate (PubChem CID 11419606) has the molecular formula C25H24O6S and a molecular weight of 452.53 g/mol. Its IUPAC name is dimethyl 2-[2-(benzenesulfonyl)buta-2,3-dienyl]-2-(4-phenylbut-3-ynyl)propanedioate.
| Compound Name | dimethyl 2-[2-(benzenesulfonyl)buta-2,3-dienyl]-2-(4-phenylbut-3-ynyl)propanedioate |
|---|---|
| PubChem CID | 11419606 |
| Molecular Formula | C25H24O6S |
| Molecular Weight | 452.53 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | dimethyl 2-[2-(benzenesulfonyl)buta-2,3-dienyl]-2-(4-phenylbut-3-ynyl)propanedioate |
| SMILES | C=C=C(CC(CCC#Cc1ccccc1)(C(=O)OC)C(=O)OC)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C25H24O6S/c1-4-21(32(28,29)22-16-9-6-10-17-22)19-25(23(26)30-2,24(27)31-3)18-12-11-15-20-13-7-5-8-14-20/h5-10,13-14,16-17H,1,12,18-19H2,2-3H3 |
| InChIKey | RZKATADKSJFXEK-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.53 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|