C27H28O8S2 — CID 46243359
dimethyl 2,2-bis[3-(benzenesulfonyl)penta-3,4-dienyl]propanedioate (PubChem CID 46243359) has the molecular formula C27H28O8S2 and a molecular weight of 544.65 g/mol. Its IUPAC name is dimethyl 2,2-bis[3-(benzenesulfonyl)penta-3,4-dienyl]propanedioate.
| Compound Name | dimethyl 2,2-bis[3-(benzenesulfonyl)penta-3,4-dienyl]propanedioate |
|---|---|
| PubChem CID | 46243359 |
| Molecular Formula | C27H28O8S2 |
| Molecular Weight | 544.65 g/mol |
| Exact Mass | 544.12 |
| IUPAC Name | dimethyl 2,2-bis[3-(benzenesulfonyl)penta-3,4-dienyl]propanedioate |
| SMILES | C=C=C(CCC(CCC(=C=C)S(=O)(=O)c1ccccc1)(C(=O)OC)C(=O)OC)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C27H28O8S2/c1-5-21(36(30,31)23-13-9-7-10-14-23)17-19-27(25(28)34-3,26(29)35-4)20-18-22(6-2)37(32,33)24-15-11-8-12-16-24/h7-16H,1-2,17-20H2,3-4H3 |
| InChIKey | AFIALDQPZMVLQJ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 120.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.65 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|