C30H32O8S2 — CID 101451662
dimethyl 2-[(2E)-2-[7,7-bis(benzenesulfonyl)-1-methylidene-4,6,8,8a-tetrahydro-3H-naphthalen-2-ylidene]ethyl]propanedioate (PubChem CID 101451662) has the molecular formula C30H32O8S2 and a molecular weight of 584.71 g/mol. Its IUPAC name is dimethyl 2-[(2E)-2-[7,7-bis(benzenesulfonyl)-1-methylidene-4,6,8,8a-tetrahydro-3H-naphthalen-2-ylidene]ethyl]propanedioate.
| Compound Name | dimethyl 2-[(2E)-2-[7,7-bis(benzenesulfonyl)-1-methylidene-4,6,8,8a-tetrahydro-3H-naphthalen-2-ylidene]ethyl]propanedioate |
|---|---|
| PubChem CID | 101451662 |
| Molecular Formula | C30H32O8S2 |
| Molecular Weight | 584.71 g/mol |
| Exact Mass | 584.15 |
| IUPAC Name | dimethyl 2-[(2E)-2-[7,7-bis(benzenesulfonyl)-1-methylidene-4,6,8,8a-tetrahydro-3H-naphthalen-2-ylidene]ethyl]propanedioate |
| SMILES | C=C1/C(=C/CC(C(=O)OC)C(=O)OC)CCC2=CCC(S(=O)(=O)c3ccccc3)(S(=O)(=O)c3ccccc3)CC12 |
| InChI | InChI=1S/C30H32O8S2/c1-21-22(16-17-26(28(31)37-2)29(32)38-3)14-15-23-18-19-30(20-27(21)23,39(33,34)24-10-6-4-7-11-24)40(35,36)25-12-8-5-9-13-25/h4-13,16,18,26-27H,1,14-15,17,19-20H2,2-3H3/b22-16+ |
| InChIKey | QQRPHMUIQLIEMU-CJLVFECKSA-N |
| XLogP | 4.60 |
| TPSA | 120.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.71 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|