C25H26O8S2 — CID 10720710
dimethyl 2-[2-(benzenesulfonyl)buta-2,3-dienyl]-2-[(E)-4-(benzenesulfonyl)but-3-enyl]propanedioate (PubChem CID 10720710) has the molecular formula C25H26O8S2 and a molecular weight of 518.61 g/mol. Its IUPAC name is dimethyl 2-[2-(benzenesulfonyl)buta-2,3-dienyl]-2-[(E)-4-(benzenesulfonyl)but-3-enyl]propanedioate.
| Compound Name | dimethyl 2-[2-(benzenesulfonyl)buta-2,3-dienyl]-2-[(E)-4-(benzenesulfonyl)but-3-enyl]propanedioate |
|---|---|
| PubChem CID | 10720710 |
| Molecular Formula | C25H26O8S2 |
| Molecular Weight | 518.61 g/mol |
| Exact Mass | 518.11 |
| IUPAC Name | dimethyl 2-[2-(benzenesulfonyl)buta-2,3-dienyl]-2-[(E)-4-(benzenesulfonyl)but-3-enyl]propanedioate |
| SMILES | C=C=C(CC(CC/C=C/S(=O)(=O)c1ccccc1)(C(=O)OC)C(=O)OC)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C25H26O8S2/c1-4-20(35(30,31)22-15-9-6-10-16-22)19-25(23(26)32-2,24(27)33-3)17-11-12-18-34(28,29)21-13-7-5-8-14-21/h5-10,12-16,18H,1,11,17,19H2,2-3H3/b18-12+ |
| InChIKey | YFLCURNKDNOGAQ-LDADJPATSA-N |
| XLogP | 3.62 |
| TPSA | 120.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.61 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|