C19H20O6S — CID 11360884
dimethyl 2-[2-(benzenesulfonyl)buta-2,3-dienyl]-2-but-3-ynylpropanedioate (PubChem CID 11360884) has the molecular formula C19H20O6S and a molecular weight of 376.43 g/mol. Its IUPAC name is dimethyl 2-[2-(benzenesulfonyl)buta-2,3-dienyl]-2-but-3-ynylpropanedioate.
| Compound Name | dimethyl 2-[2-(benzenesulfonyl)buta-2,3-dienyl]-2-but-3-ynylpropanedioate |
|---|---|
| PubChem CID | 11360884 |
| Molecular Formula | C19H20O6S |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | dimethyl 2-[2-(benzenesulfonyl)buta-2,3-dienyl]-2-but-3-ynylpropanedioate |
| SMILES | C#CCCC(CC(=C=C)S(=O)(=O)c1ccccc1)(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C19H20O6S/c1-5-7-13-19(17(20)24-3,18(21)25-4)14-15(6-2)26(22,23)16-11-9-8-10-12-16/h1,8-12H,2,7,13-14H2,3-4H3 |
| InChIKey | KLSCBDDUBCUCGL-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|