C18H24O4S — CID 135010909
dimethyl 2-butyl-2-(3-phenylsulfanylprop-2-enyl)propanedioate (PubChem CID 135010909) has the molecular formula C18H24O4S and a molecular weight of 336.45 g/mol. Its IUPAC name is dimethyl 2-butyl-2-(3-phenylsulfanylprop-2-enyl)propanedioate.
| Compound Name | dimethyl 2-butyl-2-(3-phenylsulfanylprop-2-enyl)propanedioate |
|---|---|
| PubChem CID | 135010909 |
| Molecular Formula | C18H24O4S |
| Molecular Weight | 336.45 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | dimethyl 2-butyl-2-(3-phenylsulfanylprop-2-enyl)propanedioate |
| SMILES | CCCCC(CC=CSc1ccccc1)(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C18H24O4S/c1-4-5-12-18(16(19)21-2,17(20)22-3)13-9-14-23-15-10-7-6-8-11-15/h6-11,14H,4-5,12-13H2,1-3H3 |
| InChIKey | AVSPVMJKMOIHQR-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.45 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|