C16H22O4S — CID 52951837
dimethyl 2-[(2S,3S)-3-methylsulfanyl-2-phenylbutan-2-yl]propanedioate (PubChem CID 52951837) has the molecular formula C16H22O4S and a molecular weight of 310.42 g/mol. Its IUPAC name is dimethyl 2-[(2S,3S)-3-methylsulfanyl-2-phenylbutan-2-yl]propanedioate.
| Compound Name | dimethyl 2-[(2S,3S)-3-methylsulfanyl-2-phenylbutan-2-yl]propanedioate |
|---|---|
| PubChem CID | 52951837 |
| Molecular Formula | C16H22O4S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | dimethyl 2-[(2S,3S)-3-methylsulfanyl-2-phenylbutan-2-yl]propanedioate |
| SMILES | COC(=O)C(C(=O)OC)[C@@](C)(c1ccccc1)[C@H](C)SC |
| InChI | InChI=1S/C16H22O4S/c1-11(21-5)16(2,12-9-7-6-8-10-12)13(14(17)19-3)15(18)20-4/h6-11,13H,1-5H3/t11-,16+/m0/s1 |
| InChIKey | COWXCYFWBVJRGE-MEDUHNTESA-N |
| XLogP | 2.66 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|