About dimethyl 2-benzylpropanedioate
dimethyl 2-benzylpropanedioate (PubChem CID 10900856) has the molecular formula C12H14O4
and a molecular weight of 222.24 g/mol. Its IUPAC name is dimethyl 2-benzylpropanedioate.
Molecular Properties
| Compound Name | dimethyl 2-benzylpropanedioate |
| PubChem CID | 10900856 |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | dimethyl 2-benzylpropanedioate |
| SMILES | COC(=O)C(Cc1ccccc1)C(=O)OC |
| InChI | InChI=1S/C12H14O4/c1-15-11(13)10(12(14)16-2)8-9-6-4-3-5-7-9/h3-7,10H,8H2,1-2H3 |
| InChIKey | ZMYJSOIMFGAQRQ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze dimethyl 2-benzylpropanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 2-benzylpropanedioate?
The IUPAC name of dimethyl 2-benzylpropanedioate (CID 10900856) is dimethyl 2-benzylpropanedioate.
What is the SMILES notation for dimethyl 2-benzylpropanedioate?
The canonical SMILES for dimethyl 2-benzylpropanedioate is COC(=O)C(Cc1ccccc1)C(=O)OC.
What is the InChIKey of dimethyl 2-benzylpropanedioate?
The InChIKey is ZMYJSOIMFGAQRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O4/c1-15-11(13)10(12(14)16-2)8-9-6-4-3-5-7-9/h3-7,10H,8H2,1-2H3.
What are the key properties of dimethyl 2-benzylpropanedioate?
dimethyl 2-benzylpropanedioate has a molecular weight of 222.24 g/mol, XLogP of 1.19, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 2-benzylpropanedioate is sourced from PubChem (CID 10900856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).