C15H15NO4S — CID 10063689
trans-dimethyl (2S,4R)-2-cyano-4-phenylsulfanylcyclobutane-1,1-dicarboxylate (PubChem CID 10063689) has the molecular formula C15H15NO4S and a molecular weight of 305.36 g/mol. Its IUPAC name is trans-dimethyl (2S,4R)-2-cyano-4-phenylsulfanylcyclobutane-1,1-dicarboxylate.
| Compound Name | trans-dimethyl (2S,4R)-2-cyano-4-phenylsulfanylcyclobutane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 10063689 |
| Molecular Formula | C15H15NO4S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | trans-dimethyl (2S,4R)-2-cyano-4-phenylsulfanylcyclobutane-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)[C@@H](C#N)C[C@H]1Sc1ccccc1 |
| InChI | InChI=1S/C15H15NO4S/c1-19-13(17)15(14(18)20-2)10(9-16)8-12(15)21-11-6-4-3-5-7-11/h3-7,10,12H,8H2,1-2H3/t10-,12-/m1/s1 |
| InChIKey | TYLSKDQNKLTSNA-ZYHUDNBSSA-N |
| XLogP | 2.02 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|