C17H19NO4S — CID 101376302
dimethyl 3-cyano-4-(phenylsulfanylmethyl)cyclopentane-1,1-dicarboxylate (PubChem CID 101376302) has the molecular formula C17H19NO4S and a molecular weight of 333.41 g/mol. Its IUPAC name is dimethyl 3-cyano-4-(phenylsulfanylmethyl)cyclopentane-1,1-dicarboxylate.
| Compound Name | dimethyl 3-cyano-4-(phenylsulfanylmethyl)cyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 101376302 |
| Molecular Formula | C17H19NO4S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | dimethyl 3-cyano-4-(phenylsulfanylmethyl)cyclopentane-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC(C#N)C(CSc2ccccc2)C1 |
| InChI | InChI=1S/C17H19NO4S/c1-21-15(19)17(16(20)22-2)8-12(10-18)13(9-17)11-23-14-6-4-3-5-7-14/h3-7,12-13H,8-9,11H2,1-2H3 |
| InChIKey | VTZLAEIVCUMBDN-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|