C16H18O6S — CID 134918556
trans-trimethyl (2S,4R)-4-phenylsulfanylcyclobutane-1,1,2-tricarboxylate (PubChem CID 134918556) has the molecular formula C16H18O6S and a molecular weight of 338.38 g/mol. Its IUPAC name is trans-trimethyl (2S,4R)-4-phenylsulfanylcyclobutane-1,1,2-tricarboxylate.
| Compound Name | trans-trimethyl (2S,4R)-4-phenylsulfanylcyclobutane-1,1,2-tricarboxylate |
|---|---|
| PubChem CID | 134918556 |
| Molecular Formula | C16H18O6S |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | trans-trimethyl (2S,4R)-4-phenylsulfanylcyclobutane-1,1,2-tricarboxylate |
| SMILES | COC(=O)[C@H]1C[C@@H](Sc2ccccc2)C1(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C16H18O6S/c1-20-13(17)11-9-12(23-10-7-5-4-6-8-10)16(11,14(18)21-2)15(19)22-3/h4-8,11-12H,9H2,1-3H3/t11-,12-/m1/s1 |
| InChIKey | NWGRYSXQMATXDO-VXGBXAGGSA-N |
| XLogP | 1.67 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|