C24H36O4S — CID 135010750
cis-dimethyl (2R,3S)-2-pentyl-3-(phenylsulfanylmethyl)-4-propylcyclopentane-1,1-dicarboxylate (PubChem CID 135010750) has the molecular formula C24H36O4S and a molecular weight of 420.62 g/mol. Its IUPAC name is cis-dimethyl (2R,3S)-2-pentyl-3-(phenylsulfanylmethyl)-4-propylcyclopentane-1,1-dicarboxylate.
| Compound Name | cis-dimethyl (2R,3S)-2-pentyl-3-(phenylsulfanylmethyl)-4-propylcyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 135010750 |
| Molecular Formula | C24H36O4S |
| Molecular Weight | 420.62 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | cis-dimethyl (2R,3S)-2-pentyl-3-(phenylsulfanylmethyl)-4-propylcyclopentane-1,1-dicarboxylate |
| SMILES | CCCCC[C@@H]1[C@@H](CSc2ccccc2)C(CCC)CC1(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C24H36O4S/c1-5-7-9-15-21-20(17-29-19-13-10-8-11-14-19)18(12-6-2)16-24(21,22(25)27-3)23(26)28-4/h8,10-11,13-14,18,20-21H,5-7,9,12,15-17H2,1-4H3/t18?,20-,21+/m0/s1 |
| InChIKey | XGHCIPIZCWHYPZ-QYAPWVIVSA-N |
| XLogP | 5.74 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.62 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|