C15H18O3S — CID 85401784
methyl 2-oxo-1-(1-phenylsulfanylethyl)cyclopentane-1-carboxylate (PubChem CID 85401784) has the molecular formula C15H18O3S and a molecular weight of 278.37 g/mol. Its IUPAC name is methyl 2-oxo-1-(1-phenylsulfanylethyl)cyclopentane-1-carboxylate.
| Compound Name | methyl 2-oxo-1-(1-phenylsulfanylethyl)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 85401784 |
| Molecular Formula | C15H18O3S |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | methyl 2-oxo-1-(1-phenylsulfanylethyl)cyclopentane-1-carboxylate |
| SMILES | COC(=O)C1(C(C)Sc2ccccc2)CCCC1=O |
| InChI | InChI=1S/C15H18O3S/c1-11(19-12-7-4-3-5-8-12)15(14(17)18-2)10-6-9-13(15)16/h3-5,7-8,11H,6,9-10H2,1-2H3 |
| InChIKey | LOXGUJOFWZVOJN-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|