C38H50N2O10 — CID 162166400
tert-butyl N-benzylidenecarbamate;methyl (1S)-1-[(R)-[(2-methylpropan-2-yl)oxycarbonylamino]-phenylmethyl]-2-oxocyclopentane-1-carboxylate;methyl 2-oxocyclopentane-1-carboxylate (PubChem CID 162166400) has the molecular formula C38H50N2O10 and a molecular weight of 694.82 g/mol. Its IUPAC name is tert-butyl N-benzylidenecarbamate;methyl (1S)-1-[(R)-[(2-methylpropan-2-yl)oxycarbonylamino]-phenylmethyl]-2-oxocyclopentane-1-carboxylate;methyl 2-oxocyclopentane-1-carboxylate.
| Compound Name | tert-butyl N-benzylidenecarbamate;methyl (1S)-1-[(R)-[(2-methylpropan-2-yl)oxycarbonylamino]-phenylmethyl]-2-oxocyclopentane-1-carboxylate;methyl 2-oxocyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 162166400 |
| Molecular Formula | C38H50N2O10 |
| Molecular Weight | 694.82 g/mol |
| Exact Mass | 694.35 |
| IUPAC Name | tert-butyl N-benzylidenecarbamate;methyl (1S)-1-[(R)-[(2-methylpropan-2-yl)oxycarbonylamino]-phenylmethyl]-2-oxocyclopentane-1-carboxylate;methyl 2-oxocyclopentane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N=Cc1ccccc1.COC(=O)C1CCCC1=O.COC(=O)[C@]1([C@H](NC(=O)OC(C)(C)C)c2ccccc2)CCCC1=O |
| InChI | InChI=1S/C19H25NO5.C12H15NO2.C7H10O3/c1-18(2,3)25-17(23)20-15(13-9-6-5-7-10-13)19(16(22)24-4)12-8-11-14(19)21;1-12(2,3)15-11(14)13-9-10-7-5-4-6-8-10;1-10-7(9)5-3-2-4-6(5)8/h5-7,9-10,15H,8,11-12H2,1-4H3,(H,20,23);4-9H,1-3H3;5H,2-4H2,1H3/t15-,19-;;/m1../s1 |
| InChIKey | ZNEOSCWQRSORNH-LEVQAPRMSA-N |
| XLogP | 6.73 |
| TPSA | 163.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.82 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|