C16H18O3S — CID 164673227
(4S)-4-ethenyl-4-methyl-3-(3-phenylsulfanylpropanoyl)oxolan-2-one (PubChem CID 164673227) has the molecular formula C16H18O3S and a molecular weight of 290.38 g/mol. Its IUPAC name is (4S)-4-ethenyl-4-methyl-3-(3-phenylsulfanylpropanoyl)oxolan-2-one.
| Compound Name | (4S)-4-ethenyl-4-methyl-3-(3-phenylsulfanylpropanoyl)oxolan-2-one |
|---|---|
| PubChem CID | 164673227 |
| Molecular Formula | C16H18O3S |
| Molecular Weight | 290.38 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | (4S)-4-ethenyl-4-methyl-3-(3-phenylsulfanylpropanoyl)oxolan-2-one |
| SMILES | C=C[C@]1(C)COC(=O)C1C(=O)CCSc1ccccc1 |
| InChI | InChI=1S/C16H18O3S/c1-3-16(2)11-19-15(18)14(16)13(17)9-10-20-12-7-5-4-6-8-12/h3-8,14H,1,9-11H2,2H3/t14?,16-/m1/s1 |
| InChIKey | HARKGKBJIIHDRY-BZSJEYESSA-N |
| XLogP | 3.10 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.38 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|