C18H24O4S — CID 11404942
ethyl (4S)-4-ethenyl-2-hydroxy-4-methyl-2-(2-phenylsulfanylethyl)oxolane-3-carboxylate (PubChem CID 11404942) has the molecular formula C18H24O4S and a molecular weight of 336.45 g/mol. Its IUPAC name is ethyl (4S)-4-ethenyl-2-hydroxy-4-methyl-2-(2-phenylsulfanylethyl)oxolane-3-carboxylate.
| Compound Name | ethyl (4S)-4-ethenyl-2-hydroxy-4-methyl-2-(2-phenylsulfanylethyl)oxolane-3-carboxylate |
|---|---|
| PubChem CID | 11404942 |
| Molecular Formula | C18H24O4S |
| Molecular Weight | 336.45 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | ethyl (4S)-4-ethenyl-2-hydroxy-4-methyl-2-(2-phenylsulfanylethyl)oxolane-3-carboxylate |
| SMILES | C=C[C@]1(C)COC(O)(CCSc2ccccc2)C1C(=O)OCC |
| InChI | InChI=1S/C18H24O4S/c1-4-17(3)13-22-18(20,15(17)16(19)21-5-2)11-12-23-14-9-7-6-8-10-14/h4,6-10,15,20H,1,5,11-13H2,2-3H3/t15?,17-,18?/m1/s1 |
| InChIKey | HGQUTZCCLDDVHE-IIIMJFFVSA-N |
| XLogP | 3.26 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.45 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|