C19H24O4S — CID 164673228
(4R,5R,9R)-9-ethenyl-2,2,9-trimethyl-4-(2-phenylsulfanylethyl)-1,3,7-trioxaspiro[4.4]nonan-6-one (PubChem CID 164673228) has the molecular formula C19H24O4S and a molecular weight of 348.46 g/mol. Its IUPAC name is (4R,5R,9R)-9-ethenyl-2,2,9-trimethyl-4-(2-phenylsulfanylethyl)-1,3,7-trioxaspiro[4.4]nonan-6-one.
| Compound Name | (4R,5R,9R)-9-ethenyl-2,2,9-trimethyl-4-(2-phenylsulfanylethyl)-1,3,7-trioxaspiro[4.4]nonan-6-one |
|---|---|
| PubChem CID | 164673228 |
| Molecular Formula | C19H24O4S |
| Molecular Weight | 348.46 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | (4R,5R,9R)-9-ethenyl-2,2,9-trimethyl-4-(2-phenylsulfanylethyl)-1,3,7-trioxaspiro[4.4]nonan-6-one |
| SMILES | C=C[C@]1(C)COC(=O)[C@@]12OC(C)(C)O[C@@H]2CCSc1ccccc1 |
| InChI | InChI=1S/C19H24O4S/c1-5-18(4)13-21-16(20)19(18)15(22-17(2,3)23-19)11-12-24-14-9-7-6-8-10-14/h5-10,15H,1,11-13H2,2-4H3/t15-,18-,19-/m1/s1 |
| InChIKey | ZGFUXDCNNZJIBX-ATZDWAIDSA-N |
| XLogP | 3.81 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.46 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|