C19H28O6S — CID 134832786
methyl (2S)-5,6-dimethoxy-5,6-dimethyl-2-(3-phenylsulfanylpropyl)-1,4-dioxane-2-carboxylate (PubChem CID 134832786) has the molecular formula C19H28O6S and a molecular weight of 384.49 g/mol. Its IUPAC name is methyl (2S)-5,6-dimethoxy-5,6-dimethyl-2-(3-phenylsulfanylpropyl)-1,4-dioxane-2-carboxylate.
| Compound Name | methyl (2S)-5,6-dimethoxy-5,6-dimethyl-2-(3-phenylsulfanylpropyl)-1,4-dioxane-2-carboxylate |
|---|---|
| PubChem CID | 134832786 |
| Molecular Formula | C19H28O6S |
| Molecular Weight | 384.49 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | methyl (2S)-5,6-dimethoxy-5,6-dimethyl-2-(3-phenylsulfanylpropyl)-1,4-dioxane-2-carboxylate |
| SMILES | COC(=O)[C@]1(CCCSc2ccccc2)COC(C)(OC)C(C)(OC)O1 |
| InChI | InChI=1S/C19H28O6S/c1-17(22-4)18(2,23-5)25-19(14-24-17,16(20)21-3)12-9-13-26-15-10-7-6-8-11-15/h6-8,10-11H,9,12-14H2,1-5H3/t17?,18?,19-/m0/s1 |
| InChIKey | XPLXASBJVHBPMI-ACBHZAAOSA-N |
| XLogP | 3.24 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.49 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|