C15H18O6S — CID 19075911
2-(oxan-2-yloxy)-2-(phenylsulfanylmethyl)propanedioic acid (PubChem CID 19075911) has the molecular formula C15H18O6S and a molecular weight of 326.37 g/mol. Its IUPAC name is 2-(oxan-2-yloxy)-2-(phenylsulfanylmethyl)propanedioic acid.
| Compound Name | 2-(oxan-2-yloxy)-2-(phenylsulfanylmethyl)propanedioic acid |
|---|---|
| PubChem CID | 19075911 |
| Molecular Formula | C15H18O6S |
| Molecular Weight | 326.37 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | 2-(oxan-2-yloxy)-2-(phenylsulfanylmethyl)propanedioic acid |
| SMILES | O=C(O)C(CSc1ccccc1)(OC1CCCCO1)C(=O)O |
| InChI | InChI=1S/C15H18O6S/c16-13(17)15(14(18)19,21-12-8-4-5-9-20-12)10-22-11-6-2-1-3-7-11/h1-3,6-7,12H,4-5,8-10H2,(H,16,17)(H,18,19) |
| InChIKey | GRNQUCBIWDGMSO-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.37 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|