C15H20O8S — CID 5479018
(2S)-3-phenylsulfanyl-2-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropanoic acid (PubChem CID 5479018) has the molecular formula C15H20O8S and a molecular weight of 360.38 g/mol. Its IUPAC name is (2S)-3-phenylsulfanyl-2-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropanoic acid.
| Compound Name | (2S)-3-phenylsulfanyl-2-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropanoic acid |
|---|---|
| PubChem CID | 5479018 |
| Molecular Formula | C15H20O8S |
| Molecular Weight | 360.38 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | (2S)-3-phenylsulfanyl-2-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropanoic acid |
| SMILES | O=C(O)[C@@H](CSc1ccccc1)O[C@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C15H20O8S/c16-6-9-11(17)12(18)13(19)15(22-9)23-10(14(20)21)7-24-8-4-2-1-3-5-8/h1-5,9-13,15-19H,6-7H2,(H,20,21)/t9-,10-,11+,12+,13-,15-/m1/s1 |
| InChIKey | RZOWLGIDWJOWFJ-CDWXYHGHSA-N |
| XLogP | -0.95 |
| TPSA | 136.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.38 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |