C19H28O7S — CID 24906181
methyl (2S,5S,6S)-2-[(1S)-1-hydroxy-3-phenylsulfanylpropyl]-5,6-dimethoxy-5,6-dimethyl-1,4-dioxane-2-carboxylate (PubChem CID 24906181) has the molecular formula C19H28O7S and a molecular weight of 400.49 g/mol. Its IUPAC name is methyl (2S,5S,6S)-2-[(1S)-1-hydroxy-3-phenylsulfanylpropyl]-5,6-dimethoxy-5,6-dimethyl-1,4-dioxane-2-carboxylate.
| Compound Name | methyl (2S,5S,6S)-2-[(1S)-1-hydroxy-3-phenylsulfanylpropyl]-5,6-dimethoxy-5,6-dimethyl-1,4-dioxane-2-carboxylate |
|---|---|
| PubChem CID | 24906181 |
| Molecular Formula | C19H28O7S |
| Molecular Weight | 400.49 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | methyl (2S,5S,6S)-2-[(1S)-1-hydroxy-3-phenylsulfanylpropyl]-5,6-dimethoxy-5,6-dimethyl-1,4-dioxane-2-carboxylate |
| SMILES | COC(=O)[C@@]1([C@@H](O)CCSc2ccccc2)CO[C@](C)(OC)[C@@](C)(OC)O1 |
| InChI | InChI=1S/C19H28O7S/c1-17(23-4)18(2,24-5)26-19(13-25-17,16(21)22-3)15(20)11-12-27-14-9-7-6-8-10-14/h6-10,15,20H,11-13H2,1-5H3/t15-,17-,18-,19-/m0/s1 |
| InChIKey | PSMIGEMYCVJUPW-WNHJNPCNSA-N |
| XLogP | 2.21 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.49 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |