C14H18O4S — CID 11460239
ethyl (2R,3R)-2-hydroxy-3-phenylsulfanylcarbonylpentanoate (PubChem CID 11460239) has the molecular formula C14H18O4S and a molecular weight of 282.36 g/mol. Its IUPAC name is ethyl (2R,3R)-2-hydroxy-3-phenylsulfanylcarbonylpentanoate.
| Compound Name | ethyl (2R,3R)-2-hydroxy-3-phenylsulfanylcarbonylpentanoate |
|---|---|
| PubChem CID | 11460239 |
| Molecular Formula | C14H18O4S |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | ethyl (2R,3R)-2-hydroxy-3-phenylsulfanylcarbonylpentanoate |
| SMILES | CCOC(=O)[C@H](O)[C@@H](CC)C(=O)Sc1ccccc1 |
| InChI | InChI=1S/C14H18O4S/c1-3-11(12(15)13(16)18-4-2)14(17)19-10-8-6-5-7-9-10/h5-9,11-12,15H,3-4H2,1-2H3/t11-,12-/m1/s1 |
| InChIKey | FGXDYKKMKBYGKG-VXGBXAGGSA-N |
| XLogP | 2.26 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|