C14H15O6S- — CID 134834919
4-ethoxy-3-hydroxy-3-methyl-4-oxo-2-phenylsulfanylcarbonylbutanoate (PubChem CID 134834919) has the molecular formula C14H15O6S- and a molecular weight of 311.33 g/mol. Its IUPAC name is 4-ethoxy-3-hydroxy-3-methyl-4-oxo-2-phenylsulfanylcarbonylbutanoate.
| Compound Name | 4-ethoxy-3-hydroxy-3-methyl-4-oxo-2-phenylsulfanylcarbonylbutanoate |
|---|---|
| PubChem CID | 134834919 |
| Molecular Formula | C14H15O6S- |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | 4-ethoxy-3-hydroxy-3-methyl-4-oxo-2-phenylsulfanylcarbonylbutanoate |
| SMILES | CCOC(=O)C(C)(O)C(C(=O)[O-])C(=O)Sc1ccccc1 |
| InChI | InChI=1S/C14H16O6S/c1-3-20-13(18)14(2,19)10(11(15)16)12(17)21-9-7-5-4-6-8-9/h4-8,10,19H,3H2,1-2H3,(H,15,16)/p-1 |
| InChIKey | XGKNBOAACCNKGS-UHFFFAOYSA-M |
| XLogP | -0.01 |
| TPSA | 103.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|