C16H22O4S — CID 10859870
ethyl (2S,3R)-2-hydroxy-5-methyl-3-phenylsulfanylcarbonylhexanoate (PubChem CID 10859870) has the molecular formula C16H22O4S and a molecular weight of 310.42 g/mol. Its IUPAC name is ethyl (2S,3R)-2-hydroxy-5-methyl-3-phenylsulfanylcarbonylhexanoate.
| Compound Name | ethyl (2S,3R)-2-hydroxy-5-methyl-3-phenylsulfanylcarbonylhexanoate |
|---|---|
| PubChem CID | 10859870 |
| Molecular Formula | C16H22O4S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | ethyl (2S,3R)-2-hydroxy-5-methyl-3-phenylsulfanylcarbonylhexanoate |
| SMILES | CCOC(=O)[C@@H](O)[C@@H](CC(C)C)C(=O)Sc1ccccc1 |
| InChI | InChI=1S/C16H22O4S/c1-4-20-15(18)14(17)13(10-11(2)3)16(19)21-12-8-6-5-7-9-12/h5-9,11,13-14,17H,4,10H2,1-3H3/t13-,14+/m1/s1 |
| InChIKey | IWVHYQIWGKCYIS-KGLIPLIRSA-N |
| XLogP | 2.89 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|