C16H22O4S — CID 102351016
methyl (6R,7S)-6-hydroxy-7-methyl-8-oxo-8-phenylsulfanyloctanoate (PubChem CID 102351016) has the molecular formula C16H22O4S and a molecular weight of 310.41 g/mol. Its IUPAC name is methyl (6R,7S)-6-hydroxy-7-methyl-8-oxo-8-phenylsulfanyloctanoate.
| Compound Name | methyl (6R,7S)-6-hydroxy-7-methyl-8-oxo-8-phenylsulfanyloctanoate |
|---|---|
| PubChem CID | 102351016 |
| Molecular Formula | C16H22O4S |
| Molecular Weight | 310.41 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | methyl (6R,7S)-6-hydroxy-7-methyl-8-oxo-8-phenylsulfanyloctanoate |
| SMILES | COC(=O)CCCC[C@@H](O)[C@H](C)C(=O)Sc1ccccc1 |
| InChI | InChI=1S/C16H22O4S/c1-12(14(17)10-6-7-11-15(18)20-2)16(19)21-13-8-4-3-5-9-13/h3-5,8-9,12,14,17H,6-7,10-11H2,1-2H3/t12-,14+/m0/s1 |
| InChIKey | UVOXTMHVEBTFKR-GXTWGEPZSA-N |
| XLogP | 3.04 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.41 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|