C17H18O6S — CID 134871056
dimethyl (2S,3R)-2-acetyloxy-3-(3-phenylsulfanylprop-2-ynyl)butanedioate (PubChem CID 134871056) has the molecular formula C17H18O6S and a molecular weight of 350.39 g/mol. Its IUPAC name is dimethyl (2S,3R)-2-acetyloxy-3-(3-phenylsulfanylprop-2-ynyl)butanedioate.
| Compound Name | dimethyl (2S,3R)-2-acetyloxy-3-(3-phenylsulfanylprop-2-ynyl)butanedioate |
|---|---|
| PubChem CID | 134871056 |
| Molecular Formula | C17H18O6S |
| Molecular Weight | 350.39 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | dimethyl (2S,3R)-2-acetyloxy-3-(3-phenylsulfanylprop-2-ynyl)butanedioate |
| SMILES | COC(=O)C(CC#CSc1ccccc1)[C@H](OC(C)=O)C(=O)OC |
| InChI | InChI=1S/C17H18O6S/c1-12(18)23-15(17(20)22-3)14(16(19)21-2)10-7-11-24-13-8-5-4-6-9-13/h4-6,8-9,14-15H,10H2,1-3H3/t14?,15-/m0/s1 |
| InChIKey | ZYOQMHYXHGTLJK-LOACHALJSA-N |
| XLogP | 2.02 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.39 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|