C16H22O7S — CID 171755850
diethyl (2R,3S)-2-(benzenesulfonyloxy)-3-ethylbutanedioate (PubChem CID 171755850) has the molecular formula C16H22O7S and a molecular weight of 358.41 g/mol. Its IUPAC name is diethyl (2R,3S)-2-(benzenesulfonyloxy)-3-ethylbutanedioate.
| Compound Name | diethyl (2R,3S)-2-(benzenesulfonyloxy)-3-ethylbutanedioate |
|---|---|
| PubChem CID | 171755850 |
| Molecular Formula | C16H22O7S |
| Molecular Weight | 358.41 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | diethyl (2R,3S)-2-(benzenesulfonyloxy)-3-ethylbutanedioate |
| SMILES | CCOC(=O)[C@@H](CC)[C@@H](OS(=O)(=O)c1ccccc1)C(=O)OCC |
| InChI | InChI=1S/C16H22O7S/c1-4-13(15(17)21-5-2)14(16(18)22-6-3)23-24(19,20)12-10-8-7-9-11-12/h7-11,13-14H,4-6H2,1-3H3/t13-,14+/m0/s1 |
| InChIKey | IYTSSPRGRZPUMB-UONOGXRCSA-N |
| XLogP | 1.91 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.41 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|