C23H38O8SSi — CID 10097580
1-O-ethyl 4-O-(2-methylpropyl) (2S,3S)-2-[tert-butyl(dimethyl)silyl]oxy-3-(4-methylphenyl)sulfonyloxybutanedioate (PubChem CID 10097580) has the molecular formula C23H38O8SSi and a molecular weight of 502.70 g/mol. Its IUPAC name is 1-O-ethyl 4-O-(2-methylpropyl) (2S,3S)-2-[tert-butyl(dimethyl)silyl]oxy-3-(4-methylphenyl)sulfonyloxybutanedioate.
| Compound Name | 1-O-ethyl 4-O-(2-methylpropyl) (2S,3S)-2-[tert-butyl(dimethyl)silyl]oxy-3-(4-methylphenyl)sulfonyloxybutanedioate |
|---|---|
| PubChem CID | 10097580 |
| Molecular Formula | C23H38O8SSi |
| Molecular Weight | 502.70 g/mol |
| Exact Mass | 502.21 |
| IUPAC Name | 1-O-ethyl 4-O-(2-methylpropyl) (2S,3S)-2-[tert-butyl(dimethyl)silyl]oxy-3-(4-methylphenyl)sulfonyloxybutanedioate |
| SMILES | CCOC(=O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](OS(=O)(=O)c1ccc(C)cc1)C(=O)OCC(C)C |
| InChI | InChI=1S/C23H38O8SSi/c1-10-28-22(25)20(31-33(8,9)23(5,6)7)19(21(24)29-15-16(2)3)30-32(26,27)18-13-11-17(4)12-14-18/h11-14,16,19-20H,10,15H2,1-9H3/t19-,20-/m0/s1 |
| InChIKey | FBIUIWNABZFQMA-PMACEKPBSA-N |
| XLogP | 4.22 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.70 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|