C14H18O7S — CID 15512758
dimethyl (2R,3S)-2-methyl-3-(4-methylphenyl)sulfonyloxybutanedioate (PubChem CID 15512758) has the molecular formula C14H18O7S and a molecular weight of 330.36 g/mol. Its IUPAC name is dimethyl (2R,3S)-2-methyl-3-(4-methylphenyl)sulfonyloxybutanedioate.
| Compound Name | dimethyl (2R,3S)-2-methyl-3-(4-methylphenyl)sulfonyloxybutanedioate |
|---|---|
| PubChem CID | 15512758 |
| Molecular Formula | C14H18O7S |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | dimethyl (2R,3S)-2-methyl-3-(4-methylphenyl)sulfonyloxybutanedioate |
| SMILES | COC(=O)[C@@H](OS(=O)(=O)c1ccc(C)cc1)[C@@H](C)C(=O)OC |
| InChI | InChI=1S/C14H18O7S/c1-9-5-7-11(8-6-9)22(17,18)21-12(14(16)20-4)10(2)13(15)19-3/h5-8,10,12H,1-4H3/t10-,12+/m1/s1 |
| InChIKey | IWHNYCBSQRNZMV-PWSUYJOCSA-N |
| XLogP | 1.05 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|