C11H12O6S — CID 10967632
[(3R,4R)-4-hydroxy-2-oxooxolan-3-yl] 4-methylbenzenesulfonate (PubChem CID 10967632) has the molecular formula C11H12O6S and a molecular weight of 272.28 g/mol. Its IUPAC name is [(3R,4R)-4-hydroxy-2-oxooxolan-3-yl] 4-methylbenzenesulfonate.
| Compound Name | [(3R,4R)-4-hydroxy-2-oxooxolan-3-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10967632 |
| Molecular Formula | C11H12O6S |
| Molecular Weight | 272.28 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | [(3R,4R)-4-hydroxy-2-oxooxolan-3-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@H]2C(=O)OC[C@H]2O)cc1 |
| InChI | InChI=1S/C11H12O6S/c1-7-2-4-8(5-3-7)18(14,15)17-10-9(12)6-16-11(10)13/h2-5,9-10,12H,6H2,1H3/t9-,10-/m1/s1 |
| InChIKey | KJGZEHGMFRYVBO-NXEZZACHSA-N |
| XLogP | -0.01 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.28 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|