C15H20O8S — CID 10067066
diethyl (2S,3S)-2-hydroxy-3-(4-methylphenyl)sulfonyloxybutanedioate (PubChem CID 10067066) has the molecular formula C15H20O8S and a molecular weight of 360.38 g/mol. Its IUPAC name is diethyl (2S,3S)-2-hydroxy-3-(4-methylphenyl)sulfonyloxybutanedioate.
| Compound Name | diethyl (2S,3S)-2-hydroxy-3-(4-methylphenyl)sulfonyloxybutanedioate |
|---|---|
| PubChem CID | 10067066 |
| Molecular Formula | C15H20O8S |
| Molecular Weight | 360.38 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | diethyl (2S,3S)-2-hydroxy-3-(4-methylphenyl)sulfonyloxybutanedioate |
| SMILES | CCOC(=O)[C@@H](O)[C@H](OS(=O)(=O)c1ccc(C)cc1)C(=O)OCC |
| InChI | InChI=1S/C15H20O8S/c1-4-21-14(17)12(16)13(15(18)22-5-2)23-24(19,20)11-8-6-10(3)7-9-11/h6-9,12-13,16H,4-5H2,1-3H3/t12-,13-/m0/s1 |
| InChIKey | CNLOWGMSIACIFE-STQMWFEESA-N |
| XLogP | 0.56 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.38 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|