C13H16O5S — CID 45266879
(5,5-dimethyl-2-oxooxolan-3-yl)methyl benzenesulfonate (PubChem CID 45266879) has the molecular formula C13H16O5S and a molecular weight of 284.33 g/mol. Its IUPAC name is (5,5-dimethyl-2-oxooxolan-3-yl)methyl benzenesulfonate.
| Compound Name | (5,5-dimethyl-2-oxooxolan-3-yl)methyl benzenesulfonate |
|---|---|
| PubChem CID | 45266879 |
| Molecular Formula | C13H16O5S |
| Molecular Weight | 284.33 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | (5,5-dimethyl-2-oxooxolan-3-yl)methyl benzenesulfonate |
| SMILES | CC1(C)CC(COS(=O)(=O)c2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C13H16O5S/c1-13(2)8-10(12(14)18-13)9-17-19(15,16)11-6-4-3-5-7-11/h3-7,10H,8-9H2,1-2H3 |
| InChIKey | WJKVLVWWXMKMBD-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.33 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|