C18H26O7S — CID 171755863
dipropyl (2R,3S)-2-(benzenesulfonyloxy)-3-ethylbutanedioate (PubChem CID 171755863) has the molecular formula C18H26O7S and a molecular weight of 386.47 g/mol. Its IUPAC name is dipropyl (2R,3S)-2-(benzenesulfonyloxy)-3-ethylbutanedioate.
| Compound Name | dipropyl (2R,3S)-2-(benzenesulfonyloxy)-3-ethylbutanedioate |
|---|---|
| PubChem CID | 171755863 |
| Molecular Formula | C18H26O7S |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | dipropyl (2R,3S)-2-(benzenesulfonyloxy)-3-ethylbutanedioate |
| SMILES | CCCOC(=O)[C@@H](CC)[C@@H](OS(=O)(=O)c1ccccc1)C(=O)OCCC |
| InChI | InChI=1S/C18H26O7S/c1-4-12-23-17(19)15(6-3)16(18(20)24-13-5-2)25-26(21,22)14-10-8-7-9-11-14/h7-11,15-16H,4-6,12-13H2,1-3H3/t15-,16+/m0/s1 |
| InChIKey | YMAVPUVKVJFBLT-JKSUJKDBSA-N |
| XLogP | 2.69 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|