C19H26O6S — CID 134937834
dimethyl (2R,3R)-2-[(R)-cyclohexyl(phenylsulfanyl)methoxy]-3-hydroxybutanedioate (PubChem CID 134937834) has the molecular formula C19H26O6S and a molecular weight of 382.48 g/mol. Its IUPAC name is dimethyl (2R,3R)-2-[(R)-cyclohexyl(phenylsulfanyl)methoxy]-3-hydroxybutanedioate.
| Compound Name | dimethyl (2R,3R)-2-[(R)-cyclohexyl(phenylsulfanyl)methoxy]-3-hydroxybutanedioate |
|---|---|
| PubChem CID | 134937834 |
| Molecular Formula | C19H26O6S |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | dimethyl (2R,3R)-2-[(R)-cyclohexyl(phenylsulfanyl)methoxy]-3-hydroxybutanedioate |
| SMILES | COC(=O)[C@H](O)[C@@H](O[C@H](Sc1ccccc1)C1CCCCC1)C(=O)OC |
| InChI | InChI=1S/C19H26O6S/c1-23-17(21)15(20)16(18(22)24-2)25-19(13-9-5-3-6-10-13)26-14-11-7-4-8-12-14/h4,7-8,11-13,15-16,19-20H,3,5-6,9-10H2,1-2H3/t15-,16-,19-/m1/s1 |
| InChIKey | OFHNCZQMCALCHB-GPMSIDNRSA-N |
| XLogP | 2.78 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|