C18H24O5S — CID 46854835
[(2R)-1-(oxan-2-yloxy)-3-phenylsulfanylpropan-2-yl] 3-oxobutanoate (PubChem CID 46854835) has the molecular formula C18H24O5S and a molecular weight of 352.45 g/mol. Its IUPAC name is [(2R)-1-(oxan-2-yloxy)-3-phenylsulfanylpropan-2-yl] 3-oxobutanoate.
| Compound Name | [(2R)-1-(oxan-2-yloxy)-3-phenylsulfanylpropan-2-yl] 3-oxobutanoate |
|---|---|
| PubChem CID | 46854835 |
| Molecular Formula | C18H24O5S |
| Molecular Weight | 352.45 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | [(2R)-1-(oxan-2-yloxy)-3-phenylsulfanylpropan-2-yl] 3-oxobutanoate |
| SMILES | CC(=O)CC(=O)O[C@H](COC1CCCCO1)CSc1ccccc1 |
| InChI | InChI=1S/C18H24O5S/c1-14(19)11-17(20)23-15(12-22-18-9-5-6-10-21-18)13-24-16-7-3-2-4-8-16/h2-4,7-8,15,18H,5-6,9-13H2,1H3/t15-,18?/m1/s1 |
| InChIKey | XSKZROMNBDQQNW-NNJIEVJOSA-N |
| XLogP | 3.21 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.45 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|