C25H26Cl2O5S — CID 70910070
[1-(oxan-2-yloxy)-3-phenylsulfanylpropan-2-yl] 2-[(2,3-dichlorophenyl)methylidene]-3-oxobutanoate (PubChem CID 70910070) has the molecular formula C25H26Cl2O5S and a molecular weight of 509.45 g/mol. Its IUPAC name is [1-(oxan-2-yloxy)-3-phenylsulfanylpropan-2-yl] 2-[(2,3-dichlorophenyl)methylidene]-3-oxobutanoate.
| Compound Name | [1-(oxan-2-yloxy)-3-phenylsulfanylpropan-2-yl] 2-[(2,3-dichlorophenyl)methylidene]-3-oxobutanoate |
|---|---|
| PubChem CID | 70910070 |
| Molecular Formula | C25H26Cl2O5S |
| Molecular Weight | 509.45 g/mol |
| Exact Mass | 508.09 |
| IUPAC Name | [1-(oxan-2-yloxy)-3-phenylsulfanylpropan-2-yl] 2-[(2,3-dichlorophenyl)methylidene]-3-oxobutanoate |
| SMILES | CC(=O)C(=Cc1cccc(Cl)c1Cl)C(=O)OC(COC1CCCCO1)CSc1ccccc1 |
| InChI | InChI=1S/C25H26Cl2O5S/c1-17(28)21(14-18-8-7-11-22(26)24(18)27)25(29)32-19(15-31-23-12-5-6-13-30-23)16-33-20-9-3-2-4-10-20/h2-4,7-11,14,19,23H,5-6,12-13,15-16H2,1H3 |
| InChIKey | STEIKPJSIIAOFT-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.45 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|