C40H40O10 — CID 90294852
[(3R,4R,5R,6R)-4,5,6-tribenzoyloxy-7-(oxan-2-yloxy)heptan-3-yl] benzoate (PubChem CID 90294852) has the molecular formula C40H40O10 and a molecular weight of 680.75 g/mol. Its IUPAC name is [(3R,4R,5R,6R)-4,5,6-tribenzoyloxy-7-(oxan-2-yloxy)heptan-3-yl] benzoate.
| Compound Name | [(3R,4R,5R,6R)-4,5,6-tribenzoyloxy-7-(oxan-2-yloxy)heptan-3-yl] benzoate |
|---|---|
| PubChem CID | 90294852 |
| Molecular Formula | C40H40O10 |
| Molecular Weight | 680.75 g/mol |
| Exact Mass | 680.26 |
| IUPAC Name | [(3R,4R,5R,6R)-4,5,6-tribenzoyloxy-7-(oxan-2-yloxy)heptan-3-yl] benzoate |
| SMILES | CC[C@@H](OC(=O)c1ccccc1)[C@@H](OC(=O)c1ccccc1)[C@H](OC(=O)c1ccccc1)[C@@H](COC1CCCCO1)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C40H40O10/c1-2-32(47-37(41)28-17-7-3-8-18-28)35(49-39(43)30-21-11-5-12-22-30)36(50-40(44)31-23-13-6-14-24-31)33(27-46-34-25-15-16-26-45-34)48-38(42)29-19-9-4-10-20-29/h3-14,17-24,32-36H,2,15-16,25-27H2,1H3/t32-,33-,34?,35-,36-/m1/s1 |
| InChIKey | SCHDPVIGVFZTGW-CNQPLCCCSA-N |
| XLogP | 6.84 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.75 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|