C20H25IN2O4 — CID 68996571
[3-(2-methylimidazol-1-yl)-1-(oxan-2-yloxy)butan-2-yl] 4-iodobenzoate (PubChem CID 68996571) has the molecular formula C20H25IN2O4 and a molecular weight of 484.33 g/mol. Its IUPAC name is [3-(2-methylimidazol-1-yl)-1-(oxan-2-yloxy)butan-2-yl] 4-iodobenzoate.
| Compound Name | [3-(2-methylimidazol-1-yl)-1-(oxan-2-yloxy)butan-2-yl] 4-iodobenzoate |
|---|---|
| PubChem CID | 68996571 |
| Molecular Formula | C20H25IN2O4 |
| Molecular Weight | 484.33 g/mol |
| Exact Mass | 484.09 |
| IUPAC Name | [3-(2-methylimidazol-1-yl)-1-(oxan-2-yloxy)butan-2-yl] 4-iodobenzoate |
| SMILES | Cc1nccn1C(C)C(COC1CCCCO1)OC(=O)c1ccc(I)cc1 |
| InChI | InChI=1S/C20H25IN2O4/c1-14(23-11-10-22-15(23)2)18(13-26-19-5-3-4-12-25-19)27-20(24)16-6-8-17(21)9-7-16/h6-11,14,18-19H,3-5,12-13H2,1-2H3 |
| InChIKey | QXGYSFWEGWQEPV-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.33 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|