C21H27N3O3 — CID 9382268
[(2R)-1-(cycloheptylamino)-1-oxopropan-2-yl] 4-(5-methylpyrazol-1-yl)benzoate (PubChem CID 9382268) has the molecular formula C21H27N3O3 and a molecular weight of 369.47 g/mol. Its IUPAC name is [(2R)-1-(cycloheptylamino)-1-oxopropan-2-yl] 4-(5-methylpyrazol-1-yl)benzoate.
| Compound Name | [(2R)-1-(cycloheptylamino)-1-oxopropan-2-yl] 4-(5-methylpyrazol-1-yl)benzoate |
|---|---|
| PubChem CID | 9382268 |
| Molecular Formula | C21H27N3O3 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | [(2R)-1-(cycloheptylamino)-1-oxopropan-2-yl] 4-(5-methylpyrazol-1-yl)benzoate |
| SMILES | Cc1ccnn1-c1ccc(C(=O)O[C@H](C)C(=O)NC2CCCCCC2)cc1 |
| InChI | InChI=1S/C21H27N3O3/c1-15-13-14-22-24(15)19-11-9-17(10-12-19)21(26)27-16(2)20(25)23-18-7-5-3-4-6-8-18/h9-14,16,18H,3-8H2,1-2H3,(H,23,25)/t16-/m1/s1 |
| InChIKey | NBUZAHVQNAPYBV-MRXNPFEDSA-N |
| XLogP | 3.57 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |