C21H24BrN3O4 — CID 174235084
[(2S)-4-(4-bromophenyl)-2-[2-[(1S)-1-(oxan-2-yloxy)ethyl]imidazol-1-yl]but-3-ynyl]carbamic acid (PubChem CID 174235084) has the molecular formula C21H24BrN3O4 and a molecular weight of 462.34 g/mol. Its IUPAC name is [(2S)-4-(4-bromophenyl)-2-[2-[(1S)-1-(oxan-2-yloxy)ethyl]imidazol-1-yl]but-3-ynyl]carbamic acid.
| Compound Name | [(2S)-4-(4-bromophenyl)-2-[2-[(1S)-1-(oxan-2-yloxy)ethyl]imidazol-1-yl]but-3-ynyl]carbamic acid |
|---|---|
| PubChem CID | 174235084 |
| Molecular Formula | C21H24BrN3O4 |
| Molecular Weight | 462.34 g/mol |
| Exact Mass | 461.10 |
| IUPAC Name | [(2S)-4-(4-bromophenyl)-2-[2-[(1S)-1-(oxan-2-yloxy)ethyl]imidazol-1-yl]but-3-ynyl]carbamic acid |
| SMILES | C[C@H](OC1CCCCO1)c1nccn1[C@@H](C#Cc1ccc(Br)cc1)CNC(=O)O |
| InChI | InChI=1S/C21H24BrN3O4/c1-15(29-19-4-2-3-13-28-19)20-23-11-12-25(20)18(14-24-21(26)27)10-7-16-5-8-17(22)9-6-16/h5-6,8-9,11-12,15,18-19,24H,2-4,13-14H2,1H3,(H,26,27)/t15-,18-,19?/m0/s1 |
| InChIKey | ARKXAZYUFVNYGA-SIYBWXAISA-N |
| XLogP | 4.11 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.34 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|