C30H34N2O5 — CID 170792750
(2S)-4-[4-[4-(3-methyloxetan-3-yl)oxyphenyl]phenyl]-2-[2-[(1S)-1-(oxan-2-yloxy)ethyl]imidazol-1-yl]but-3-yn-1-ol (PubChem CID 170792750) has the molecular formula C30H34N2O5 and a molecular weight of 502.61 g/mol. Its IUPAC name is (2S)-4-[4-[4-(3-methyloxetan-3-yl)oxyphenyl]phenyl]-2-[2-[(1S)-1-(oxan-2-yloxy)ethyl]imidazol-1-yl]but-3-yn-1-ol.
| Compound Name | (2S)-4-[4-[4-(3-methyloxetan-3-yl)oxyphenyl]phenyl]-2-[2-[(1S)-1-(oxan-2-yloxy)ethyl]imidazol-1-yl]but-3-yn-1-ol |
|---|---|
| PubChem CID | 170792750 |
| Molecular Formula | C30H34N2O5 |
| Molecular Weight | 502.61 g/mol |
| Exact Mass | 502.25 |
| IUPAC Name | (2S)-4-[4-[4-(3-methyloxetan-3-yl)oxyphenyl]phenyl]-2-[2-[(1S)-1-(oxan-2-yloxy)ethyl]imidazol-1-yl]but-3-yn-1-ol |
| SMILES | C[C@H](OC1CCCCO1)c1nccn1[C@@H](C#Cc1ccc(-c2ccc(OC3(C)COC3)cc2)cc1)CO |
| InChI | InChI=1S/C30H34N2O5/c1-22(36-28-5-3-4-18-35-28)29-31-16-17-32(29)26(19-33)13-8-23-6-9-24(10-7-23)25-11-14-27(15-12-25)37-30(2)20-34-21-30/h6-7,9-12,14-17,22,26,28,33H,3-5,18-21H2,1-2H3/t22-,26-,28?/m0/s1 |
| InChIKey | WRYFJQXWSJWRGG-ZMDQLYFMSA-N |
| XLogP | 4.91 |
| TPSA | 74.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.61 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|