C20H22BrN2O3Si — CID 177227528
CID 177227528 (PubChem CID 177227528) has the molecular formula C20H22BrN2O3Si and a molecular weight of 446.40 g/mol.
| Compound Name | CID 177227528 |
|---|---|
| PubChem CID | 177227528 |
| Molecular Formula | C20H22BrN2O3Si |
| Molecular Weight | 446.40 g/mol |
| Exact Mass | 445.06 |
| IUPAC Name | — |
| SMILES | C[C@@]([Si])(OC1CCCCO1)c1nccn1C(C#Cc1ccc(Br)cc1)CO |
| InChI | InChI=1S/C20H22BrN2O3Si/c1-20(27,26-18-4-2-3-13-25-18)19-22-11-12-23(19)17(14-24)10-7-15-5-8-16(21)9-6-15/h5-6,8-9,11-12,17-18,24H,2-4,13-14H2,1H3/t17?,18?,20-/m0/s1 |
| InChIKey | WKULFBUYZWBBCC-QLOJAFMTSA-N |
| XLogP | 3.12 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.40 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|