C14H13BrN2O2 — CID 177227250
4-(4-bromophenyl)-2-[2-(hydroxymethyl)imidazol-1-yl]but-3-yn-1-ol (PubChem CID 177227250) has the molecular formula C14H13BrN2O2 and a molecular weight of 321.17 g/mol. Its IUPAC name is 4-(4-bromophenyl)-2-[2-(hydroxymethyl)imidazol-1-yl]but-3-yn-1-ol.
| Compound Name | 4-(4-bromophenyl)-2-[2-(hydroxymethyl)imidazol-1-yl]but-3-yn-1-ol |
|---|---|
| PubChem CID | 177227250 |
| Molecular Formula | C14H13BrN2O2 |
| Molecular Weight | 321.17 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | 4-(4-bromophenyl)-2-[2-(hydroxymethyl)imidazol-1-yl]but-3-yn-1-ol |
| SMILES | OCc1nccn1C(C#Cc1ccc(Br)cc1)CO |
| InChI | InChI=1S/C14H13BrN2O2/c15-12-4-1-11(2-5-12)3-6-13(9-18)17-8-7-16-14(17)10-19/h1-2,4-5,7-8,13,18-19H,9-10H2 |
| InChIKey | VLWNHDBRCQYQKG-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.17 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|