C21H25BrN2O3 — CID 170943114
(3S)-5-(4-bromophenyl)-3-[2-[(1S)-1-(oxan-2-yloxy)ethyl]imidazol-1-yl]pent-4-yn-1-ol (PubChem CID 170943114) has the molecular formula C21H25BrN2O3 and a molecular weight of 433.35 g/mol. Its IUPAC name is (3S)-5-(4-bromophenyl)-3-[2-[(1S)-1-(oxan-2-yloxy)ethyl]imidazol-1-yl]pent-4-yn-1-ol.
| Compound Name | (3S)-5-(4-bromophenyl)-3-[2-[(1S)-1-(oxan-2-yloxy)ethyl]imidazol-1-yl]pent-4-yn-1-ol |
|---|---|
| PubChem CID | 170943114 |
| Molecular Formula | C21H25BrN2O3 |
| Molecular Weight | 433.35 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | (3S)-5-(4-bromophenyl)-3-[2-[(1S)-1-(oxan-2-yloxy)ethyl]imidazol-1-yl]pent-4-yn-1-ol |
| SMILES | C[C@H](OC1CCCCO1)c1nccn1[C@H](C#Cc1ccc(Br)cc1)CCO |
| InChI | InChI=1S/C21H25BrN2O3/c1-16(27-20-4-2-3-15-26-20)21-23-12-13-24(21)19(11-14-25)10-7-17-5-8-18(22)9-6-17/h5-6,8-9,12-13,16,19-20,25H,2-4,11,14-15H2,1H3/t16-,19+,20?/m0/s1 |
| InChIKey | LPNGIWSMULFDJE-VPSRXSMPSA-N |
| XLogP | 4.22 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.35 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|