C29H28N4O4 — CID 174239416
4-[2-[4-[3-[[2-[1-(oxan-2-yloxy)ethyl]imidazol-1-yl]methyl]-1,2-oxazol-5-yl]phenyl]ethynyl]benzamide (PubChem CID 174239416) has the molecular formula C29H28N4O4 and a molecular weight of 496.57 g/mol. Its IUPAC name is 4-[2-[4-[3-[[2-[1-(oxan-2-yloxy)ethyl]imidazol-1-yl]methyl]-1,2-oxazol-5-yl]phenyl]ethynyl]benzamide.
| Compound Name | 4-[2-[4-[3-[[2-[1-(oxan-2-yloxy)ethyl]imidazol-1-yl]methyl]-1,2-oxazol-5-yl]phenyl]ethynyl]benzamide |
|---|---|
| PubChem CID | 174239416 |
| Molecular Formula | C29H28N4O4 |
| Molecular Weight | 496.57 g/mol |
| Exact Mass | 496.21 |
| IUPAC Name | 4-[2-[4-[3-[[2-[1-(oxan-2-yloxy)ethyl]imidazol-1-yl]methyl]-1,2-oxazol-5-yl]phenyl]ethynyl]benzamide |
| SMILES | CC(OC1CCCCO1)c1nccn1Cc1cc(-c2ccc(C#Cc3ccc(C(N)=O)cc3)cc2)on1 |
| InChI | InChI=1S/C29H28N4O4/c1-20(36-27-4-2-3-17-35-27)29-31-15-16-33(29)19-25-18-26(37-32-25)23-11-7-21(8-12-23)5-6-22-9-13-24(14-10-22)28(30)34/h7-16,18,20,27H,2-4,17,19H2,1H3,(H2,30,34) |
| InChIKey | CUJKLPAPYSOWQH-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.57 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|