C31H31N3O5 — CID 175576407
3-[4-[2-[4-[3-[[2-[1-(oxan-2-yloxy)ethyl]imidazol-1-yl]methyl]-1,2-oxazol-5-yl]phenyl]ethynyl]phenyl]propanoic acid (PubChem CID 175576407) has the molecular formula C31H31N3O5 and a molecular weight of 525.61 g/mol. Its IUPAC name is 3-[4-[2-[4-[3-[[2-[1-(oxan-2-yloxy)ethyl]imidazol-1-yl]methyl]-1,2-oxazol-5-yl]phenyl]ethynyl]phenyl]propanoic acid.
| Compound Name | 3-[4-[2-[4-[3-[[2-[1-(oxan-2-yloxy)ethyl]imidazol-1-yl]methyl]-1,2-oxazol-5-yl]phenyl]ethynyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 175576407 |
| Molecular Formula | C31H31N3O5 |
| Molecular Weight | 525.61 g/mol |
| Exact Mass | 525.23 |
| IUPAC Name | 3-[4-[2-[4-[3-[[2-[1-(oxan-2-yloxy)ethyl]imidazol-1-yl]methyl]-1,2-oxazol-5-yl]phenyl]ethynyl]phenyl]propanoic acid |
| SMILES | CC(OC1CCCCO1)c1nccn1Cc1cc(-c2ccc(C#Cc3ccc(CCC(=O)O)cc3)cc2)on1 |
| InChI | InChI=1S/C31H31N3O5/c1-22(38-30-4-2-3-19-37-30)31-32-17-18-34(31)21-27-20-28(39-33-27)26-14-11-25(12-15-26)10-7-23-5-8-24(9-6-23)13-16-29(35)36/h5-6,8-9,11-12,14-15,17-18,20,22,30H,2-4,13,16,19,21H2,1H3,(H,35,36) |
| InChIKey | OMJMTJQUGDZZEO-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 99.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.61 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|